Atropine sulfate Catalog No.:M27722-C 2-Methoxycinnamaldehyde effectively inhibits platelet-derived growth

2-Methoxycinnamaldehyde effectively inhibits platelet-derived growth factor (PDGF)-induced HASMC migration

Smiles: C[C@@]12O[C@H]1[C@H](C)[C@@H]1C[C@@](O)(NC(=O)O1)[C@@H](C=CC=C(C)CC1=CC(OC)=C(Cl)C(=C1)NC(=O)C[C@@H]2OC(=O)C(C)C)OC |c:19

CAS Number: 70-00-8

and increased sensitivity to cytotoxic chemotherapies

MDM2-IN-1 (Compound 30) is a synthetic MDM2-p53 interaction (MDM2) inhibitor and contains the trans (D-)configuration

Atropine sulfate Catalog No.:M27722-C 2-Methoxycinnamaldehyde effectively inhibits platelet-derived growthAtropine (Tropine tropate) sulfate is a broad spectrum and competitive muscarinic acetylcholine receptor (mAChR) antagonist. Product information CAS Number: 55 48 1 Molecular Weight: 676. 82 Formula: C34H48N2O10S Chemical Name: bis((1R,5S) 8 methyl 8 azabicyclo[3. 2. 1]octan 3 yl 3 hydroxy 2 phenylpropanoate); sulfuric acid Smiles: CN1[C@@H]2CC(C[C@H]1CC2)OC(=O)C(CO)C1C=CC=CC=1. CN1[C@@H]2CC(C[C@H]1CC2)OC(=O)C(CO)C1C=CC=CC=1. OS(O)(=O)=O InChiKey: